C23H21N5O3 — CID 98074981
5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-methyl-10-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 98074981) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-methyl-10-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-methyl-10-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 98074981 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 5-(5,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-11-methyl-10-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | Cc1cc(C(=O)N2Cc3nc4c(-c5ccccc5)c(C)[nH]n4c(=O)c3C2)c(=O)[nH]c1C |
| InChI | InChI=1S/C23H21N5O3/c1-12-9-16(21(29)24-13(12)2)22(30)27-10-17-18(11-27)25-20-19(15-7-5-4-6-8-15)14(3)26-28(20)23(17)31/h4-9,26H,10-11H2,1-3H3,(H,24,29) |
| InChIKey | DLVZMICXVCPPMY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |