C20H19N5O2 — CID 98075152
5-[(1S)-cyclohex-3-ene-1-carbonyl]-11-pyridin-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 98075152) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 5-[(1S)-cyclohex-3-ene-1-carbonyl]-11-pyridin-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 5-[(1S)-cyclohex-3-ene-1-carbonyl]-11-pyridin-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 98075152 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 5-[(1S)-cyclohex-3-ene-1-carbonyl]-11-pyridin-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | O=C([C@@H]1CC=CCC1)N1Cc2nc3cc(-c4ccccn4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C20H19N5O2/c26-19(13-6-2-1-3-7-13)24-11-14-17(12-24)22-18-10-16(23-25(18)20(14)27)15-8-4-5-9-21-15/h1-2,4-5,8-10,13,23H,3,6-7,11-12H2/t13-/m1/s1 |
| InChIKey | DKKACRNYNTXPRV-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|