C24H24N6O2 — CID 98076149
(1S,13S)-7-methyl-16-[(4-pyrimidin-2-yloxyphenyl)methyl]-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one (PubChem CID 98076149) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is (1S,13S)-7-methyl-16-[(4-pyrimidin-2-yloxyphenyl)methyl]-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one.
| Compound Name | (1S,13S)-7-methyl-16-[(4-pyrimidin-2-yloxyphenyl)methyl]-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one |
|---|---|
| PubChem CID | 98076149 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (1S,13S)-7-methyl-16-[(4-pyrimidin-2-yloxyphenyl)methyl]-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one |
| SMILES | Cc1cc2nc3c(c(=O)n2[nH]1)C[C@@H]1CC[C@@H](C3)N1Cc1ccc(Oc2ncccn2)cc1 |
| InChI | InChI=1S/C24H24N6O2/c1-15-11-22-27-21-13-18-6-5-17(12-20(21)23(31)30(22)28-15)29(18)14-16-3-7-19(8-4-16)32-24-25-9-2-10-26-24/h2-4,7-11,17-18,28H,5-6,12-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | QRAOOHDGAFMJPJ-ROUUACIJSA-N |
| XLogP | 3.05 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |