C13H10ClNO4 — CID 98076875
(1S,2R,6S,8R)-5-(4-chlorophenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one (PubChem CID 98076875) has the molecular formula C13H10ClNO4 and a molecular weight of 279.68 g/mol. Its IUPAC name is (1S,2R,6S,8R)-5-(4-chlorophenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one.
| Compound Name | (1S,2R,6S,8R)-5-(4-chlorophenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one |
|---|---|
| PubChem CID | 98076875 |
| Molecular Formula | C13H10ClNO4 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (1S,2R,6S,8R)-5-(4-chlorophenyl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one |
| SMILES | O=C1[C@@H]2OC[C@H](O2)[C@@H]2ON=C(c3ccc(Cl)cc3)[C@H]12 |
| InChI | InChI=1S/C13H10ClNO4/c14-7-3-1-6(2-4-7)10-9-11(16)13-17-5-8(18-13)12(9)19-15-10/h1-4,8-9,12-13H,5H2/t8-,9+,12-,13+/m0/s1 |
| InChIKey | BWOGNRRIYDTYOH-GAQJKIJGSA-N |
| XLogP | 1.38 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |