C15H24N4O — CID 98078743
N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetamide (PubChem CID 98078743) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 98078743 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-[(1S)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(3,5-dimethyl-1,2,4-triazol-1-yl)acetamide |
| SMILES | Cc1nc(C)n(CC(=O)N[C@@H](C)[C@@H]2C[C@@H]3CC[C@@H]2C3)n1 |
| InChI | InChI=1S/C15H24N4O/c1-9(14-7-12-4-5-13(14)6-12)16-15(20)8-19-11(3)17-10(2)18-19/h9,12-14H,4-8H2,1-3H3,(H,16,20)/t9-,12+,13+,14-/m0/s1 |
| InChIKey | HLUMYKHGSKSRAZ-VKKKGTNTSA-N |
| XLogP | 1.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |