C22H31N5O4 — CID 98080380
11-butanoyl-5-[(2S)-1-(3-methoxypropanoyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 98080380) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 11-butanoyl-5-[(2S)-1-(3-methoxypropanoyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-butanoyl-5-[(2S)-1-(3-methoxypropanoyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 98080380 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 11-butanoyl-5-[(2S)-1-(3-methoxypropanoyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCCC(=O)N1CCc2nc3cc([C@@H]4CCCCN4C(=O)CCOC)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C22H31N5O4/c1-3-6-20(28)25-11-8-16-15(14-25)22(30)27-19(23-16)13-17(24-27)18-7-4-5-10-26(18)21(29)9-12-31-2/h13,18,24H,3-12,14H2,1-2H3/t18-/m0/s1 |
| InChIKey | GGYBFLFOPFZPJT-SFHVURJKSA-N |
| XLogP | 1.80 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |