C13H14N2OS2 — CID 98081640
3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 98081640) has the molecular formula C13H14N2OS2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 98081640 |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2[nH]c(=S)n1[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C13H14N2OS2/c16-12-9-3-4-18-11(9)14-13(17)15(12)10-6-7-1-2-8(10)5-7/h3-4,7-8,10H,1-2,5-6H2,(H,14,17)/t7-,8-,10+/m1/s1 |
| InChIKey | QWHQQEPDPHQHFL-MRTMQBJTSA-N |
| XLogP | 3.48 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|