C18H22N4O7 — CID 98085278
(4S,5R)-5-nitro-1-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 98085278) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is (4S,5R)-5-nitro-1-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | (4S,5R)-5-nitro-1-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 98085278 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (4S,5R)-5-nitro-1-propan-2-yl-4-(3,4,5-trimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | COc1cc([C@H]2c3c(n(C(C)C)[nH]c3=O)NC(=O)[C@@H]2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C18H22N4O7/c1-8(2)21-16-13(17(23)20-21)12(14(22(25)26)18(24)19-16)9-6-10(27-3)15(29-5)11(7-9)28-4/h6-8,12,14H,1-5H3,(H,19,24)(H,20,23)/t12-,14+/m0/s1 |
| InChIKey | ZFLODGGQURYOIA-GXTWGEPZSA-N |
| XLogP | 1.51 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|