C13H14N4O2 — CID 98085711
(3R,3aS)-2'-amino-3a-methyl-2,5'-dioxospiro[1,4,5,6-tetrahydroindole-3,4'-1H-pyrrole]-3'-carbonitrile (PubChem CID 98085711) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is (3R,3aS)-2'-amino-3a-methyl-2,5'-dioxospiro[1,4,5,6-tetrahydroindole-3,4'-1H-pyrrole]-3'-carbonitrile.
| Compound Name | (3R,3aS)-2'-amino-3a-methyl-2,5'-dioxospiro[1,4,5,6-tetrahydroindole-3,4'-1H-pyrrole]-3'-carbonitrile |
|---|---|
| PubChem CID | 98085711 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3R,3aS)-2'-amino-3a-methyl-2,5'-dioxospiro[1,4,5,6-tetrahydroindole-3,4'-1H-pyrrole]-3'-carbonitrile |
| SMILES | C[C@@]12CCCC=C1NC(=O)[C@@]21C(=O)NC(N)=C1C#N |
| InChI | InChI=1S/C13H14N4O2/c1-12-5-3-2-4-8(12)16-10(18)13(12)7(6-14)9(15)17-11(13)19/h4H,2-3,5,15H2,1H3,(H,16,18)(H,17,19)/t12-,13+/m1/s1 |
| InChIKey | NJCVMGHUMAVNLC-OLZOCXBDSA-N |
| XLogP | 0.00 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|