About 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one
4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one (PubChem CID 98086764) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one |
| PubChem CID | 98086764 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one |
| SMILES | CC(C)C1=C(O)C(C)(C)NC1=O |
| InChI | InChI=1S/C9H15NO2/c1-5(2)6-7(11)9(3,4)10-8(6)12/h5,11H,1-4H3,(H,10,12) |
| InChIKey | ARBZQWHWZINNEQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one?
The IUPAC name of 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one (CID 98086764) is 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one.
What is the SMILES notation for 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one?
The canonical SMILES for 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one is CC(C)C1=C(O)C(C)(C)NC1=O.
What is the InChIKey of 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one?
The InChIKey is ARBZQWHWZINNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-5(2)6-7(11)9(3,4)10-8(6)12/h5,11H,1-4H3,(H,10,12).
What are the key properties of 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one?
4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one has a molecular weight of 169.22 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5,5-dimethyl-3-propan-2-yl-1H-pyrrol-2-one is sourced from PubChem (CID 98086764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).