About (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol
(Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol (PubChem CID 98086898) has the molecular formula C10H18S2
and a molecular weight of 202.39 g/mol. Its IUPAC name is (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol.
Molecular Properties
| Compound Name | (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol |
| PubChem CID | 98086898 |
| Molecular Formula | C10H18S2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol |
| SMILES | CC(C)[C@H]1CC[C@](C)(/C=C\S)S1 |
| InChI | InChI=1S/C10H18S2/c1-8(2)9-4-5-10(3,12-9)6-7-11/h6-9,11H,4-5H2,1-3H3/b7-6-/t9-,10-/m1/s1 |
| InChIKey | PIZZPGWXGGJZBV-ITMFEAPISA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol?
The IUPAC name of (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol (CID 98086898) is (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol.
What is the SMILES notation for (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol?
The canonical SMILES for (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol is CC(C)[C@H]1CC[C@](C)(/C=C\S)S1.
What is the InChIKey of (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol?
The InChIKey is PIZZPGWXGGJZBV-ITMFEAPISA-N. The full InChI is InChI=1S/C10H18S2/c1-8(2)9-4-5-10(3,12-9)6-7-11/h6-9,11H,4-5H2,1-3H3/b7-6-/t9-,10-/m1/s1.
What are the key properties of (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol?
(Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol has a molecular weight of 202.39 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(2R,5R)-2-methyl-5-propan-2-ylthiolan-2-yl]ethenethiol is sourced from PubChem (CID 98086898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).