About 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide
2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide (PubChem CID 980900) has the molecular formula C23H20N2O6S2
and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide.
Molecular Properties
| Compound Name | 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide |
| PubChem CID | 980900 |
| Molecular Formula | C23H20N2O6S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)c1ccc2c(c1)Cc1cc(S(=O)(=O)NCc3ccco3)ccc1-2 |
| InChI | InChI=1S/C23H20N2O6S2/c26-32(27,24-14-18-3-1-9-30-18)20-5-7-22-16(12-20)11-17-13-21(6-8-23(17)22)33(28,29)25-15-19-4-2-10-31-19/h1-10,12-13,24-25H,11,14-15H2 |
| InChIKey | HWWHZSNJWALPOF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide?
The IUPAC name of 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide (CID 980900) is 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide.
What is the SMILES notation for 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide?
The canonical SMILES for 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide is O=S(=O)(NCc1ccco1)c1ccc2c(c1)Cc1cc(S(=O)(=O)NCc3ccco3)ccc1-2.
What is the InChIKey of 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide?
The InChIKey is HWWHZSNJWALPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O6S2/c26-32(27,24-14-18-3-1-9-30-18)20-5-7-22-16(12-20)11-17-13-21(6-8-23(17)22)33(28,29)25-15-19-4-2-10-31-19/h1-10,12-13,24-25H,11,14-15H2.
What are the key properties of 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide?
2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide has a molecular weight of 484.56 g/mol, XLogP of 3.40, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,7-N-bis(furan-2-ylmethyl)-9H-fluorene-2,7-disulfonamide is sourced from PubChem (CID 980900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).