C14H9BrF3N3O4S — CID 98090196
N-[(Z)-2-(4-bromophenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 98090196) has the molecular formula C14H9BrF3N3O4S and a molecular weight of 452.21 g/mol. Its IUPAC name is N-[(Z)-2-(4-bromophenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-2-(4-bromophenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 98090196 |
| Molecular Formula | C14H9BrF3N3O4S |
| Molecular Weight | 452.21 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | N-[(Z)-2-(4-bromophenyl)sulfonyl-2-nitroethenyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])/C(=C/Nc1cc(C(F)(F)F)ccn1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9BrF3N3O4S/c15-10-1-3-11(4-2-10)26(24,25)13(21(22)23)8-20-12-7-9(5-6-19-12)14(16,17)18/h1-8H,(H,19,20)/b13-8- |
| InChIKey | VLZHBARAAOUFBB-JYRVWZFOSA-N |
| XLogP | 3.82 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|