C32H30N2O7 — CID 98091529
2-[4-[(2R)-3-benzyl-6,7,8-trimethoxy-4-oxo-1,2-dihydroquinazolin-2-yl]phenoxy]-4-methylbenzoic acid (PubChem CID 98091529) has the molecular formula C32H30N2O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is 2-[4-[(2R)-3-benzyl-6,7,8-trimethoxy-4-oxo-1,2-dihydroquinazolin-2-yl]phenoxy]-4-methylbenzoic acid.
| Compound Name | 2-[4-[(2R)-3-benzyl-6,7,8-trimethoxy-4-oxo-1,2-dihydroquinazolin-2-yl]phenoxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 98091529 |
| Molecular Formula | C32H30N2O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-[4-[(2R)-3-benzyl-6,7,8-trimethoxy-4-oxo-1,2-dihydroquinazolin-2-yl]phenoxy]-4-methylbenzoic acid |
| SMILES | COc1cc2c(c(OC)c1OC)N[C@@H](c1ccc(Oc3cc(C)ccc3C(=O)O)cc1)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C32H30N2O7/c1-19-10-15-23(32(36)37)25(16-19)41-22-13-11-21(12-14-22)30-33-27-24(17-26(38-2)28(39-3)29(27)40-4)31(35)34(30)18-20-8-6-5-7-9-20/h5-17,30,33H,18H2,1-4H3,(H,36,37)/t30-/m1/s1 |
| InChIKey | RNTUYSLMNDIXKR-SSEXGKCCSA-N |
| XLogP | 6.28 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|