About (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine
(1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine (PubChem CID 98093555) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine.
Analyze (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine?
The IUPAC name of (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine (CID 98093555) is (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine.
What is the SMILES notation for (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine?
The canonical SMILES for (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine is N[C@H]1[C@H]2C[C@H]3CS[C@H]1[C@H]3C2.
What is the InChIKey of (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine?
The InChIKey is TXMGLTDFAJJLEC-WXUMCUSRSA-N. The full InChI is InChI=1S/C8H13NS/c9-7-4-1-5-3-10-8(7)6(5)2-4/h4-8H,1-3,9H2/t4-,5-,6-,7-,8-/m0/s1.
What are the key properties of (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine?
(1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine has a molecular weight of 155.27 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S,3S,6R,7S)-4-thiatricyclo[4.2.1.03,7]nonan-2-amine is sourced from PubChem (CID 98093555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).