C32H26N4O5S — CID 98094205
ethyl (2E,5R)-7-methyl-2-[[1-[(2-nitrophenyl)methyl]indol-3-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98094205) has the molecular formula C32H26N4O5S and a molecular weight of 578.65 g/mol. Its IUPAC name is ethyl (2E,5R)-7-methyl-2-[[1-[(2-nitrophenyl)methyl]indol-3-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-7-methyl-2-[[1-[(2-nitrophenyl)methyl]indol-3-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98094205 |
| Molecular Formula | C32H26N4O5S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | ethyl (2E,5R)-7-methyl-2-[[1-[(2-nitrophenyl)methyl]indol-3-yl]methylidene]-3-oxo-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cn(Cc4ccccc4[N+](=O)[O-])c4ccccc34)c(=O)n2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H26N4O5S/c1-3-41-31(38)28-20(2)33-32-35(29(28)21-11-5-4-6-12-21)30(37)27(42-32)17-23-19-34(26-16-10-8-14-24(23)26)18-22-13-7-9-15-25(22)36(39)40/h4-17,19,29H,3,18H2,1-2H3/b27-17+/t29-/m1/s1 |
| InChIKey | GUXQJHYTOHFMQF-NULZLWRNSA-N |
| XLogP | 4.71 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|