C30H37N5O6S — CID 98094540
4-amino-5-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-5-N-(2,4-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide (PubChem CID 98094540) has the molecular formula C30H37N5O6S and a molecular weight of 595.72 g/mol. Its IUPAC name is 4-amino-5-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-5-N-(2,4-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-5-N-(2,4-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 98094540 |
| Molecular Formula | C30H37N5O6S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | 4-amino-5-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-5-N-(2,4-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide |
| SMILES | COc1cc([C@H](C(=O)NC2CCCCC2)N(C(=O)c2snc(C(N)=O)c2N)c2ccc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C30H37N5O6S/c1-16-11-12-20(17(2)13-16)35(30(38)27-23(31)24(28(32)36)34-42-27)25(29(37)33-19-9-7-6-8-10-19)18-14-21(39-3)26(41-5)22(15-18)40-4/h11-15,19,25H,6-10,31H2,1-5H3,(H2,32,36)(H,33,37)/t25-/m1/s1 |
| InChIKey | XBXMNUOEVXVZOH-RUZDIDTESA-N |
| XLogP | 4.30 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |