C28H33N5O6S — CID 98094869
4-amino-5-N-[(1S)-1-(3,4-dimethoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-5-N-(2,5-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide (PubChem CID 98094869) has the molecular formula C28H33N5O6S and a molecular weight of 567.67 g/mol. Its IUPAC name is 4-amino-5-N-[(1S)-1-(3,4-dimethoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-5-N-(2,5-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide.
| Compound Name | 4-amino-5-N-[(1S)-1-(3,4-dimethoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-5-N-(2,5-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 98094869 |
| Molecular Formula | C28H33N5O6S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 4-amino-5-N-[(1S)-1-(3,4-dimethoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-5-N-(2,5-dimethylphenyl)-1,2-thiazole-3,5-dicarboxamide |
| SMILES | COc1ccc([C@@H](C(=O)NC[C@H]2CCCO2)N(C(=O)c2snc(C(N)=O)c2N)c2cc(C)ccc2C)cc1OC |
| InChI | InChI=1S/C28H33N5O6S/c1-15-7-8-16(2)19(12-15)33(28(36)25-22(29)23(26(30)34)32-40-25)24(27(35)31-14-18-6-5-11-39-18)17-9-10-20(37-3)21(13-17)38-4/h7-10,12-13,18,24H,5-6,11,14,29H2,1-4H3,(H2,30,34)(H,31,35)/t18-,24+/m1/s1 |
| InChIKey | JYWQCCOTZWPPEQ-KOSHJBKYSA-N |
| XLogP | 3.14 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |