C11H15N3O2 — CID 98095669
(1R,3R,6S,7S)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile (PubChem CID 98095669) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (1R,3R,6S,7S)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile.
| Compound Name | (1R,3R,6S,7S)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile |
|---|---|
| PubChem CID | 98095669 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (1R,3R,6S,7S)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile |
| SMILES | C[C@@]12CC[C@@H]3C[C@@]1(C#N)N([N+](=O)[O-])C[C@@]32C |
| InChI | InChI=1S/C11H15N3O2/c1-9-7-13(14(15)16)11(6-12)5-8(9)3-4-10(9,11)2/h8H,3-5,7H2,1-2H3/t8-,9+,10+,11+/m1/s1 |
| InChIKey | KFBZGFJRHWJDSU-RCWTZXSCSA-N |
| XLogP | 1.58 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|