C34H48NO3P — CID 98095891
(1S)-N-benzyl-1-[bis[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphoryl]-1-phenylmethanamine (PubChem CID 98095891) has the molecular formula C34H48NO3P and a molecular weight of 549.74 g/mol. Its IUPAC name is (1S)-N-benzyl-1-[bis[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphoryl]-1-phenylmethanamine.
| Compound Name | (1S)-N-benzyl-1-[bis[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 98095891 |
| Molecular Formula | C34H48NO3P |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | (1S)-N-benzyl-1-[bis[[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phosphoryl]-1-phenylmethanamine |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](OP(=O)(O[C@@H]1C[C@@H]3CC[C@]1(C)C3(C)C)[C@H](NCc1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C34H48NO3P/c1-31(2)26-17-19-33(31,5)28(21-26)37-39(36,38-29-22-27-18-20-34(29,6)32(27,3)4)30(25-15-11-8-12-16-25)35-23-24-13-9-7-10-14-24/h7-16,26-30,35H,17-23H2,1-6H3/t26-,27-,28+,29+,30-,33-,34-/m0/s1 |
| InChIKey | BATYDYQRHLJKAS-ZSNGCLOSSA-N |
| XLogP | 9.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|