C28H24N2O2 — CID 98096506
3-(4-ethylanilino)-4-[1-[(2-methylphenyl)methyl]indol-3-yl]cyclobut-3-ene-1,2-dione (PubChem CID 98096506) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-(4-ethylanilino)-4-[1-[(2-methylphenyl)methyl]indol-3-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-ethylanilino)-4-[1-[(2-methylphenyl)methyl]indol-3-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 98096506 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-(4-ethylanilino)-4-[1-[(2-methylphenyl)methyl]indol-3-yl]cyclobut-3-ene-1,2-dione |
| SMILES | CCc1ccc(Nc2c(-c3cn(Cc4ccccc4C)c4ccccc34)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C28H24N2O2/c1-3-19-12-14-21(15-13-19)29-26-25(27(31)28(26)32)23-17-30(24-11-7-6-10-22(23)24)16-20-9-5-4-8-18(20)2/h4-15,17,29H,3,16H2,1-2H3 |
| InChIKey | RMDFQOZLMKQUAP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|