C22H18N2O6 — CID 98096567
2,5-dihydroxy-1-N,4-N-bis(3-methylphenyl)-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxamide (PubChem CID 98096567) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2,5-dihydroxy-1-N,4-N-bis(3-methylphenyl)-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxamide.
| Compound Name | 2,5-dihydroxy-1-N,4-N-bis(3-methylphenyl)-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 98096567 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2,5-dihydroxy-1-N,4-N-bis(3-methylphenyl)-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2=C(O)C(=O)C(C(=O)Nc3cccc(C)c3)=C(O)C2=O)c1 |
| InChI | InChI=1S/C22H18N2O6/c1-11-5-3-7-13(9-11)23-21(29)15-17(25)19(27)16(20(28)18(15)26)22(30)24-14-8-4-6-12(2)10-14/h3-10,25,28H,1-2H3,(H,23,29)(H,24,30) |
| InChIKey | SZIVPPKIMGNZSC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|