C29H28Cl2N4O4S — CID 98099758
N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 98099758) has the molecular formula C29H28Cl2N4O4S and a molecular weight of 599.54 g/mol. Its IUPAC name is N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 98099758 |
| Molecular Formula | C29H28Cl2N4O4S |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C\c2cc(C)n(-c3cc(Cl)ccc3Cl)c2C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H28Cl2N4O4S/c1-19-5-12-26(13-6-19)40(37,38)34(24-8-10-25(39-4)11-9-24)18-29(36)33-32-17-22-15-20(2)35(21(22)3)28-16-23(30)7-14-27(28)31/h5-17H,18H2,1-4H3,(H,33,36)/b32-17- |
| InChIKey | NMJSDGFJOGSTCG-KYHGBAKBSA-N |
| XLogP | 6.06 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|