C17H19NO4 — CID 98100448
benzyl N-[[(1S,5S)-5-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl]carbamate (PubChem CID 98100448) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is benzyl N-[[(1S,5S)-5-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(1S,5S)-5-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 98100448 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | benzyl N-[[(1S,5S)-5-methyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]methyl]carbamate |
| SMILES | C[C@@]12C=C[C@](CNC(=O)OCc3ccccc3)(CC(=O)C1)O2 |
| InChI | InChI=1S/C17H19NO4/c1-16-7-8-17(22-16,10-14(19)9-16)12-18-15(20)21-11-13-5-3-2-4-6-13/h2-8H,9-12H2,1H3,(H,18,20)/t16-,17-/m1/s1 |
| InChIKey | KIIANTVSZAMHOV-IAGOWNOFSA-N |
| XLogP | 2.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|