C14H10Cl3I — CID 98100495
1-chloro-3-[(1R)-2,2-dichloro-1-(4-iodophenyl)ethyl]benzene (PubChem CID 98100495) has the molecular formula C14H10Cl3I and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-chloro-3-[(1R)-2,2-dichloro-1-(4-iodophenyl)ethyl]benzene.
| Compound Name | 1-chloro-3-[(1R)-2,2-dichloro-1-(4-iodophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 98100495 |
| Molecular Formula | C14H10Cl3I |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 409.89 |
| IUPAC Name | 1-chloro-3-[(1R)-2,2-dichloro-1-(4-iodophenyl)ethyl]benzene |
| SMILES | Clc1cccc([C@@H](c2ccc(I)cc2)C(Cl)Cl)c1 |
| InChI | InChI=1S/C14H10Cl3I/c15-11-3-1-2-10(8-11)13(14(16)17)9-4-6-12(18)7-5-9/h1-8,13-14H/t13-/m1/s1 |
| InChIKey | AGDVNCQNAITBNZ-CYBMUJFWSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|