C17H24N2O2 — CID 98101275
(3R)-1-[3-(diethylamino)propyl]-3-phenylpyrrolidine-2,5-dione (PubChem CID 98101275) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3R)-1-[3-(diethylamino)propyl]-3-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[3-(diethylamino)propyl]-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98101275 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3R)-1-[3-(diethylamino)propyl]-3-phenylpyrrolidine-2,5-dione |
| SMILES | CCN(CC)CCCN1C(=O)C[C@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C17H24N2O2/c1-3-18(4-2)11-8-12-19-16(20)13-15(17(19)21)14-9-6-5-7-10-14/h5-7,9-10,15H,3-4,8,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | CTKCSDYLLGSFQU-OAHLLOKOSA-N |
| XLogP | 2.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|