C8H7BrO5 — CID 98102783
(1R,2S,3R,6R,7R,9S)-2-bromo-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid (PubChem CID 98102783) has the molecular formula C8H7BrO5 and a molecular weight of 263.04 g/mol. Its IUPAC name is (1R,2S,3R,6R,7R,9S)-2-bromo-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid.
| Compound Name | (1R,2S,3R,6R,7R,9S)-2-bromo-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 98102783 |
| Molecular Formula | C8H7BrO5 |
| Molecular Weight | 263.04 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | (1R,2S,3R,6R,7R,9S)-2-bromo-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2O[C@H]3[C@@H](OC(=O)[C@@H]31)[C@H]2Br |
| InChI | InChI=1S/C8H7BrO5/c9-3-4-1(7(10)11)2-5(13-4)6(3)14-8(2)12/h1-6H,(H,10,11)/t1-,2+,3-,4+,5+,6-/m0/s1 |
| InChIKey | BQMKEGIYBFPWOU-PYAXOIPSSA-N |
| XLogP | -0.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.04 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|