C29H42O4 — CID 98103129
ethyl 2,2-bis[(Z)-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]pentanoate (PubChem CID 98103129) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is ethyl 2,2-bis[(Z)-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]pentanoate.
| Compound Name | ethyl 2,2-bis[(Z)-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]pentanoate |
|---|---|
| PubChem CID | 98103129 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | ethyl 2,2-bis[(Z)-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]pentanoate |
| SMILES | CCCC(/C=C1\C(=O)[C@@]2(C)CC[C@H]1C2(C)C)(/C=C1\C(=O)[C@@]2(C)CC[C@H]1C2(C)C)C(=O)OCC |
| InChI | InChI=1S/C29H42O4/c1-9-13-29(24(32)33-10-2,16-18-20-11-14-27(7,22(18)30)25(20,3)4)17-19-21-12-15-28(8,23(19)31)26(21,5)6/h16-17,20-21H,9-15H2,1-8H3/b18-16-,19-17-/t20-,21-,27-,28-/m1/s1 |
| InChIKey | UQYDBFYSEFZXKP-UVGYRGNZSA-N |
| XLogP | 6.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|