C12H16O3 — CID 98103226
(2Z)-2-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetic acid (PubChem CID 98103226) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2Z)-2-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetic acid.
| Compound Name | (2Z)-2-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetic acid |
|---|---|
| PubChem CID | 98103226 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2Z)-2-[(1S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]acetic acid |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(=O)/C2=C\C(=O)O |
| InChI | InChI=1S/C12H16O3/c1-11(2)8-4-5-12(11,3)10(15)7(8)6-9(13)14/h6,8H,4-5H2,1-3H3,(H,13,14)/b7-6-/t8-,12-/m1/s1 |
| InChIKey | UVBOLVXQLDACCM-PPSQRDDLSA-N |
| XLogP | 2.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|