About F1345-0003
F1345-0003 (PubChem CID 981039) has the molecular formula C23H26N2O5S2
and a molecular weight of 474.60 g/mol. Its IUPAC name is 2,7-bis(piperidin-1-ylsulfonyl)fluoren-9-one.
Molecular Properties
| Compound Name | F1345-0003 |
| PubChem CID | 981039 |
| Molecular Formula | C23H26N2O5S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2,7-bis(piperidin-1-ylsulfonyl)fluoren-9-one |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)C4=C(C3=O)C=C(C=C4)S(=O)(=O)N5CCCCC5 |
| InChI | InChI=1S/C23H26N2O5S2/c26-23-21-15-17(31(27,28)24-11-3-1-4-12-24)7-9-19(21)20-10-8-18(16-22(20)23)32(29,30)25-13-5-2-6-14-25/h7-10,15-16H,1-6,11-14H2 |
| InChIKey | SXPGHJYFEBJAMV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 109.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | 837 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze F1345-0003 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of F1345-0003?
The IUPAC name of F1345-0003 (CID 981039) is 2,7-bis(piperidin-1-ylsulfonyl)fluoren-9-one.
What is the SMILES notation for F1345-0003?
The canonical SMILES for F1345-0003 is C1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)C4=C(C3=O)C=C(C=C4)S(=O)(=O)N5CCCCC5.
What is the InChIKey of F1345-0003?
The InChIKey is SXPGHJYFEBJAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O5S2/c26-23-21-15-17(31(27,28)24-11-3-1-4-12-24)7-9-19(21)20-10-8-18(16-22(20)23)32(29,30)25-13-5-2-6-14-25/h7-10,15-16H,1-6,11-14H2.
What are the key properties of F1345-0003?
F1345-0003 has a molecular weight of 474.60 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for F1345-0003 is sourced from PubChem (CID 981039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).