C17H15N3O3S — CID 98104707
(1R,2S,3S,4R)-3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98104707) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4R)-3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98104707 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (1R,2S,3S,4R)-3-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(=O)Nc2ccc(-c3csnn3)cc2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H15N3O3S/c21-16(14-10-1-2-11(7-10)15(14)17(22)23)18-12-5-3-9(4-6-12)13-8-24-20-19-13/h1-6,8,10-11,14-15H,7H2,(H,18,21)(H,22,23)/t10-,11-,14-,15-/m0/s1 |
| InChIKey | AWLRBTDNJSFRDF-GVARAGBVSA-N |
| XLogP | 2.67 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|