C19H10F12N2 — CID 98105012
N-[(Z)-3-[3,5-bis(trifluoromethyl)phenyl]iminoprop-1-enyl]-3,5-bis(trifluoromethyl)aniline (PubChem CID 98105012) has the molecular formula C19H10F12N2 and a molecular weight of 494.28 g/mol. Its IUPAC name is N-[(Z)-3-[3,5-bis(trifluoromethyl)phenyl]iminoprop-1-enyl]-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-3-[3,5-bis(trifluoromethyl)phenyl]iminoprop-1-enyl]-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 98105012 |
| Molecular Formula | C19H10F12N2 |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[(Z)-3-[3,5-bis(trifluoromethyl)phenyl]iminoprop-1-enyl]-3,5-bis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(/N=C/C=C\Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H10F12N2/c20-16(21,22)10-4-11(17(23,24)25)7-14(6-10)32-2-1-3-33-15-8-12(18(26,27)28)5-13(9-15)19(29,30)31/h1-9,32H/b2-1-,33-3+ |
| InChIKey | YRUIBEKLLDGFKP-ARQDNKCWSA-N |
| XLogP | 8.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|