(1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid

C14H17NO2 — CID 98105075

IUPAC(1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid
SMILESO=C(O)C1[C@@H]2C[C@@H]1CN(Cc1ccccc1)C2
InChIInChI=1S/C14H17NO2/c16-14(17)13-11-6-12(13)9-15(8-11)7-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2,(H,16,17)/t11-,12-/m1/s1
InChIKeyAPXGFMMJKBKCDE-VXGBXAGGSA-N
MW231.29 g/mol
LogP1.84
Rot. Bonds3

About (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid

(1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid (PubChem CID 98105075) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid.

Molecular Properties

Compound Name(1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid
PubChem CID98105075
Molecular FormulaC14H17NO2
Molecular Weight231.29 g/mol
Exact Mass231.13
IUPAC Name(1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid
SMILESO=C(O)C1[C@@H]2C[C@@H]1CN(Cc1ccccc1)C2
InChIInChI=1S/C14H17NO2/c16-14(17)13-11-6-12(13)9-15(8-11)7-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2,(H,16,17)/t11-,12-/m1/s1
InChIKeyAPXGFMMJKBKCDE-VXGBXAGGSA-N
XLogP1.84
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.29
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid?
The IUPAC name of (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid (CID 98105075) is (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid.
What is the SMILES notation for (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid?
The canonical SMILES for (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid is O=C(O)C1[C@@H]2C[C@@H]1CN(Cc1ccccc1)C2.
What is the InChIKey of (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid?
The InChIKey is APXGFMMJKBKCDE-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H17NO2/c16-14(17)13-11-6-12(13)9-15(8-11)7-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2,(H,16,17)/t11-,12-/m1/s1.
What are the key properties of (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid?
(1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid has a molecular weight of 231.29 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-3-benzyl-3-azabicyclo[3.1.1]heptane-6-carboxylic acid is sourced from PubChem (CID 98105075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).