C29H26N2O5 — CID 98107122
[3-[(1R,2S,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] (3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 98107122) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is [3-[(1R,2S,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] (3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [3-[(1R,2S,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] (3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 98107122 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | [3-[(1R,2S,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] (3S)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)Oc3cccc(N4C(=O)[C@H]5[C@@H]6C=C[C@H]([C@H]7C[C@H]67)[C@@H]5C4=O)c3)CC2=O)cc1 |
| InChI | InChI=1S/C29H26N2O5/c1-15-5-7-17(8-6-15)30-14-16(11-24(30)32)29(35)36-19-4-2-3-18(12-19)31-27(33)25-20-9-10-21(23-13-22(20)23)26(25)28(31)34/h2-10,12,16,20-23,25-26H,11,13-14H2,1H3/t16-,20+,21+,22+,23+,25-,26-/m0/s1 |
| InChIKey | XMPUUVORNXDGFY-WKKZXMQZSA-N |
| XLogP | 3.51 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|