C17H12Cl2N4OS — CID 98107581
(2E)-3-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 98107581) has the molecular formula C17H12Cl2N4OS and a molecular weight of 391.28 g/mol. Its IUPAC name is (2E)-3-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98107581 |
| Molecular Formula | C17H12Cl2N4OS |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | (2E)-3-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C\c2ccc(Cl)cc2)N1/N=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2N4OS/c18-14-5-1-12(2-6-14)9-20-22-17-23(16(24)11-25-17)21-10-13-3-7-15(19)8-4-13/h1-10H,11H2/b20-9-,21-10-,22-17+ |
| InChIKey | HHJBBZVEZUPRHM-JJOAUGBWSA-N |
| XLogP | 4.29 |
| TPSA | 57.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|