C12H18N4OS — CID 98107876
(1S,3R,4S)-3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 98107876) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is (1S,3R,4S)-3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3R,4S)-3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 98107876 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S,3R,4S)-3-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(=O)[C@@H]2Sc1n[nH]c(N)n1 |
| InChI | InChI=1S/C12H18N4OS/c1-11(2)6-4-5-12(11,3)8(17)7(6)18-10-14-9(13)15-16-10/h6-7H,4-5H2,1-3H3,(H3,13,14,15,16)/t6-,7-,12-/m1/s1 |
| InChIKey | JAPFNNJHWUIFSE-NQYJQULFSA-N |
| XLogP | 1.87 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |