C14H13ClN4 — CID 98111601
(1R,2R,6S,7S,8S)-8-chloro-3-phenyl-3,4,5-triazatricyclo[5.2.1.02,6]dec-4-ene-8-carbonitrile (PubChem CID 98111601) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S)-8-chloro-3-phenyl-3,4,5-triazatricyclo[5.2.1.02,6]dec-4-ene-8-carbonitrile.
| Compound Name | (1R,2R,6S,7S,8S)-8-chloro-3-phenyl-3,4,5-triazatricyclo[5.2.1.02,6]dec-4-ene-8-carbonitrile |
|---|---|
| PubChem CID | 98111601 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (1R,2R,6S,7S,8S)-8-chloro-3-phenyl-3,4,5-triazatricyclo[5.2.1.02,6]dec-4-ene-8-carbonitrile |
| SMILES | N#C[C@]1(Cl)C[C@H]2C[C@H]1[C@@H]1N=NN(c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C14H13ClN4/c15-14(8-16)7-9-6-11(14)12-13(9)19(18-17-12)10-4-2-1-3-5-10/h1-5,9,11-13H,6-7H2/t9-,11+,12+,13-,14-/m1/s1 |
| InChIKey | DWICUJLNMFJEDO-FYGCWZCISA-N |
| XLogP | 3.15 |
| TPSA | 51.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|