C14H21N — CID 98111841
(1S,2R,3S,5R,6R,8R,9R,10S)-N-propan-2-ylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-amine (PubChem CID 98111841) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (1S,2R,3S,5R,6R,8R,9R,10S)-N-propan-2-ylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-amine.
| Compound Name | (1S,2R,3S,5R,6R,8R,9R,10S)-N-propan-2-ylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-amine |
|---|---|
| PubChem CID | 98111841 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1S,2R,3S,5R,6R,8R,9R,10S)-N-propan-2-ylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-amine |
| SMILES | CC(C)NC1[C@@H]2[C@@H]3C[C@@H]4[C@@H]5C[C@H]([C@H]1[C@H]53)[C@@H]42 |
| InChI | InChI=1S/C14H21N/c1-5(2)15-14-12-8-3-6-7-4-9(10(6)12)13(14)11(7)8/h5-15H,3-4H2,1-2H3/t6-,7+,8-,9+,10-,11-,12-,13+,14?/m1/s1 |
| InChIKey | QTOODEBDJJCURP-RFQLIUHRSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |