C12H17N — CID 98111939
[(1S,2R,3S,5R,6R,8S,9R,10S)-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]methanamine (PubChem CID 98111939) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is [(1S,2R,3S,5R,6R,8S,9R,10S)-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]methanamine.
| Compound Name | [(1S,2R,3S,5R,6R,8S,9R,10S)-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]methanamine |
|---|---|
| PubChem CID | 98111939 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | [(1S,2R,3S,5R,6R,8S,9R,10S)-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]methanamine |
| SMILES | NCC1[C@@H]2[C@@H]3C[C@H]4[C@@H]5C[C@H]([C@H]1[C@H]53)[C@@H]42 |
| InChI | InChI=1S/C12H17N/c13-3-8-11-6-1-4-5-2-7(9(4)11)12(8)10(5)6/h4-12H,1-3,13H2/t4-,5-,6-,7+,8?,9+,10+,11+,12-/m0/s1 |
| InChIKey | WJJWDLWTZLFPKT-BLVCKNIESA-N |
| XLogP | 1.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |