C32H25N5O3S — CID 98112546
(2S)-2-hydroxy-N-[(E)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]-2-phenylacetamide (PubChem CID 98112546) has the molecular formula C32H25N5O3S and a molecular weight of 559.65 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(E)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | (2S)-2-hydroxy-N-[(E)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 98112546 |
| Molecular Formula | C32H25N5O3S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (2S)-2-hydroxy-N-[(E)-[5-[[5-(naphthalen-1-ylmethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]furan-2-yl]methylideneamino]-2-phenylacetamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2nnc(Cc3cccc4ccccc34)n2-c2ccccc2)o1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C32H25N5O3S/c38-30(23-11-3-1-4-12-23)31(39)35-33-21-26-18-19-29(40-26)41-32-36-34-28(37(32)25-15-5-2-6-16-25)20-24-14-9-13-22-10-7-8-17-27(22)24/h1-19,21,30,38H,20H2,(H,35,39)/b33-21+/t30-/m0/s1 |
| InChIKey | IUXZTFYAXUTQET-FZEGLUMNSA-N |
| XLogP | 5.94 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|