C13H19NO7 — CID 98112632
[(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-3,3-dimethylbutan-2-yl] carbamate (PubChem CID 98112632) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is [(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-3,3-dimethylbutan-2-yl] carbamate.
| Compound Name | [(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-3,3-dimethylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 98112632 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-3,3-dimethylbutan-2-yl] carbamate |
| SMILES | CC1(C)OC(=O)C(=C(O)[C@H](OC(N)=O)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C13H19NO7/c1-12(2,3)8(19-11(14)18)7(15)6-9(16)20-13(4,5)21-10(6)17/h8,15H,1-5H3,(H2,14,18)/t8-/m0/s1 |
| InChIKey | KTHSANZHHFSOGT-QMMMGPOBSA-N |
| XLogP | 1.14 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|