C8H12F3NO — CID 98113051
(1S,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 98113051) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is (1S,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 98113051 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (1S,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(C(F)(F)F)C[C@@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C8H12F3NO/c9-8(10,11)7(13)3-5-1-2-6(4-7)12-5/h5-6,12-13H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | RZACNMVDSIXILK-WDSKDSINSA-N |
| XLogP | 1.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |