About (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide
(5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 98115320) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide.
Molecular Properties
| Compound Name | (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide |
| PubChem CID | 98115320 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@H](CC(C(=O)N(C)C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H27NO/c1-14-4-6-17(7-5-14)19-9-15-8-16(10-19)12-20(11-15,13-19)18(22)21(2)3/h4-7,15-16H,8-13H2,1-3H3/t15-,16-,19?,20?/m0/s1 |
| InChIKey | CNWVHXWWXFHUSC-MVYVIFSASA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide?
The IUPAC name of (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide (CID 98115320) is (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide.
What is the SMILES notation for (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide?
The canonical SMILES for (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide is Cc1ccc(C23C[C@@H]4C[C@H](CC(C(=O)N(C)C)(C4)C2)C3)cc1.
What is the InChIKey of (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide?
The InChIKey is CNWVHXWWXFHUSC-MVYVIFSASA-N. The full InChI is InChI=1S/C20H27NO/c1-14-4-6-17(7-5-14)19-9-15-8-16(10-19)12-20(11-15,13-19)18(22)21(2)3/h4-7,15-16H,8-13H2,1-3H3/t15-,16-,19?,20?/m0/s1.
What are the key properties of (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide?
(5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide has a molecular weight of 297.44 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7S)-N,N-dimethyl-3-(4-methylphenyl)adamantane-1-carboxamide is sourced from PubChem (CID 98115320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).