About N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide
N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide (PubChem CID 98115658) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide |
| PubChem CID | 98115658 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide |
| SMILES | CC[C@H](C)N(CC)C(=O)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C15H25NO3/c1-6-10(3)16(7-2)14(19)13-11(17)8-15(4,5)9-12(13)18/h10,13H,6-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | LOVSRDCEAGXGQK-JTQLQIEISA-N |
| XLogP | 2.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide?
The IUPAC name of N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide (CID 98115658) is N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide.
What is the SMILES notation for N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide?
The canonical SMILES for N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide is CC[C@H](C)N(CC)C(=O)C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide?
The InChIKey is LOVSRDCEAGXGQK-JTQLQIEISA-N. The full InChI is InChI=1S/C15H25NO3/c1-6-10(3)16(7-2)14(19)13-11(17)8-15(4,5)9-12(13)18/h10,13H,6-9H2,1-5H3/t10-/m0/s1.
What are the key properties of N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide?
N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide has a molecular weight of 267.37 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-butan-2-yl]-N-ethyl-4,4-dimethyl-2,6-dioxocyclohexane-1-carboxamide is sourced from PubChem (CID 98115658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).