About (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one
(2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one (PubChem CID 98115931) has the molecular formula C16H17NO4
and a molecular weight of 287.31 g/mol. Its IUPAC name is (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one.
Molecular Properties
| Compound Name | (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one |
| PubChem CID | 98115931 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one |
| SMILES | CCc1ccc2c(c1)N[C@@]1(C=C(C)OC(=O)C1=C(C)O)O2 |
| InChI | InChI=1S/C16H17NO4/c1-4-11-5-6-13-12(7-11)17-16(21-13)8-9(2)20-15(19)14(16)10(3)18/h5-8,17-18H,4H2,1-3H3/t16-/m0/s1 |
| InChIKey | FZUDLCQCRRHUHK-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one?
The IUPAC name of (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one (CID 98115931) is (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one.
What is the SMILES notation for (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one?
The canonical SMILES for (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one is CCc1ccc2c(c1)N[C@@]1(C=C(C)OC(=O)C1=C(C)O)O2.
What is the InChIKey of (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one?
The InChIKey is FZUDLCQCRRHUHK-INIZCTEOSA-N. The full InChI is InChI=1S/C16H17NO4/c1-4-11-5-6-13-12(7-11)17-16(21-13)8-9(2)20-15(19)14(16)10(3)18/h5-8,17-18H,4H2,1-3H3/t16-/m0/s1.
What are the key properties of (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one?
(2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one has a molecular weight of 287.31 g/mol, XLogP of 3.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-ethyl-3'-(1-hydroxyethylidene)-6'-methylspiro[3H-1,3-benzoxazole-2,4'-pyran]-2'-one is sourced from PubChem (CID 98115931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).