(2S)-2-methylpyrrolidine-1-sulfonyl chloride

C5H10ClNO2S — CID 98116156

IUPAC(2S)-2-methylpyrrolidine-1-sulfonyl chloride
SMILESC[C@H]1CCCN1S(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO2S/c1-5-3-2-4-7(5)10(6,8)9/h5H,2-4H2,1H3/t5-/m0/s1
InChIKeyXDUTVEHZDSNVHL-YFKPBYRVSA-N
MW183.66 g/mol
LogP0.95
Rot. Bonds1

About (2S)-2-methylpyrrolidine-1-sulfonyl chloride

(2S)-2-methylpyrrolidine-1-sulfonyl chloride (PubChem CID 98116156) has the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. Its IUPAC name is (2S)-2-methylpyrrolidine-1-sulfonyl chloride.

Molecular Properties

Compound Name(2S)-2-methylpyrrolidine-1-sulfonyl chloride
PubChem CID98116156
Molecular FormulaC5H10ClNO2S
Molecular Weight183.66 g/mol
Exact Mass183.01
IUPAC Name(2S)-2-methylpyrrolidine-1-sulfonyl chloride
SMILESC[C@H]1CCCN1S(=O)(=O)Cl
InChIInChI=1S/C5H10ClNO2S/c1-5-3-2-4-7(5)10(6,8)9/h5H,2-4H2,1H3/t5-/m0/s1
InChIKeyXDUTVEHZDSNVHL-YFKPBYRVSA-N
XLogP0.95
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.66
LogP ≤ 50.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2S)-2-methylpyrrolidine-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-methylpyrrolidine-1-sulfonyl chloride?
The IUPAC name of (2S)-2-methylpyrrolidine-1-sulfonyl chloride (CID 98116156) is (2S)-2-methylpyrrolidine-1-sulfonyl chloride.
What is the SMILES notation for (2S)-2-methylpyrrolidine-1-sulfonyl chloride?
The canonical SMILES for (2S)-2-methylpyrrolidine-1-sulfonyl chloride is C[C@H]1CCCN1S(=O)(=O)Cl.
What is the InChIKey of (2S)-2-methylpyrrolidine-1-sulfonyl chloride?
The InChIKey is XDUTVEHZDSNVHL-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H10ClNO2S/c1-5-3-2-4-7(5)10(6,8)9/h5H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of (2S)-2-methylpyrrolidine-1-sulfonyl chloride?
(2S)-2-methylpyrrolidine-1-sulfonyl chloride has a molecular weight of 183.66 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methylpyrrolidine-1-sulfonyl chloride is sourced from PubChem (CID 98116156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).