C10H12O4 — CID 98116720
(3S)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 98116720) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (3S)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | (3S)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 98116720 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3S)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | COC1=C(C=O)C=C(C)C(=O)[C@H]1OC |
| InChI | InChI=1S/C10H12O4/c1-6-4-7(5-11)9(13-2)10(14-3)8(6)12/h4-5,10H,1-3H3/t10-/m1/s1 |
| InChIKey | JOWTWSVSCCBZEG-SNVBAGLBSA-N |
| XLogP | 0.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|