C12H4Cl2F9NO2 — CID 98117456
N-(2,4-dichlorophenyl)-2,2-difluoro-2-[(2S)-2,3,3,4,4,5,5-heptafluorooxolan-2-yl]acetamide (PubChem CID 98117456) has the molecular formula C12H4Cl2F9NO2 and a molecular weight of 436.06 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2,2-difluoro-2-[(2S)-2,3,3,4,4,5,5-heptafluorooxolan-2-yl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2,2-difluoro-2-[(2S)-2,3,3,4,4,5,5-heptafluorooxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 98117456 |
| Molecular Formula | C12H4Cl2F9NO2 |
| Molecular Weight | 436.06 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2,2-difluoro-2-[(2S)-2,3,3,4,4,5,5-heptafluorooxolan-2-yl]acetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C(F)(F)[C@@]1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H4Cl2F9NO2/c13-4-1-2-6(5(14)3-4)24-7(25)8(15,16)11(21)9(17,18)10(19,20)12(22,23)26-11/h1-3H,(H,24,25)/t11-/m1/s1 |
| InChIKey | SQYNIERFOHZXDA-LLVKDONJSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|