[(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate

C7H11NO5S — CID 98117772

IUPAC[(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate
SMILESCNC1=CC[C@@](O)(OS(=O)(=O)O)C=C1
InChIInChI=1S/C7H11NO5S/c1-8-6-2-4-7(9,5-3-6)13-14(10,11)12/h2-4,8-9H,5H2,1H3,(H,10,11,12)/t7-/m0/s1
InChIKeyROMZOYMDNYLQFH-ZETCQYMHSA-N
MW221.23 g/mol
LogP-0.44
Rot. Bonds3

About [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate

[(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate (PubChem CID 98117772) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate.

Molecular Properties

Compound Name[(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate
PubChem CID98117772
Molecular FormulaC7H11NO5S
Molecular Weight221.23 g/mol
Exact Mass221.04
IUPAC Name[(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate
SMILESCNC1=CC[C@@](O)(OS(=O)(=O)O)C=C1
InChIInChI=1S/C7H11NO5S/c1-8-6-2-4-7(9,5-3-6)13-14(10,11)12/h2-4,8-9H,5H2,1H3,(H,10,11,12)/t7-/m0/s1
InChIKeyROMZOYMDNYLQFH-ZETCQYMHSA-N
XLogP-0.44
TPSA95.86 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.23
LogP ≤ 5-0.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate?
The IUPAC name of [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate (CID 98117772) is [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate.
What is the SMILES notation for [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate?
The canonical SMILES for [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate is CNC1=CC[C@@](O)(OS(=O)(=O)O)C=C1.
What is the InChIKey of [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate?
The InChIKey is ROMZOYMDNYLQFH-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H11NO5S/c1-8-6-2-4-7(9,5-3-6)13-14(10,11)12/h2-4,8-9H,5H2,1H3,(H,10,11,12)/t7-/m0/s1.
What are the key properties of [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate?
[(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate has a molecular weight of 221.23 g/mol, XLogP of -0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-hydroxy-4-(methylamino)cyclohexa-2,4-dien-1-yl] hydrogen sulfate is sourced from PubChem (CID 98117772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).