C22H29N3O — CID 98117834
(1S,9S)-11-[[4-(diethylamino)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 98117834) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (1S,9S)-11-[[4-(diethylamino)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[[4-(diethylamino)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 98117834 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (1S,9S)-11-[[4-(diethylamino)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CCN(CC)c1ccc(CN2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 |
| InChI | InChI=1S/C22H29N3O/c1-3-24(4-2)20-10-8-17(9-11-20)13-23-14-18-12-19(16-23)21-6-5-7-22(26)25(21)15-18/h5-11,18-19H,3-4,12-16H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | ZNTCWSXJLCXLJA-OALUTQOASA-N |
| XLogP | 3.31 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|